C26H31NO5 — CID 42624722
N-[(1R)-1-[(3aS,5S,6R,6aS)-3a-ethenyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]-N-benzylhydroxylamine (PubChem CID 42624722) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[(1R)-1-[(3aS,5S,6R,6aS)-3a-ethenyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]-N-benzylhydroxylamine.
| Compound Name | N-[(1R)-1-[(3aS,5S,6R,6aS)-3a-ethenyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]-N-benzylhydroxylamine |
|---|---|
| PubChem CID | 42624722 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | N-[(1R)-1-[(3aS,5S,6R,6aS)-3a-ethenyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]-N-benzylhydroxylamine |
| SMILES | C=C[C@H]([C@@H]1O[C@@]2(C=C)OC(C)(C)O[C@H]2[C@@H]1OCc1ccccc1)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C26H31NO5/c1-5-21(27(28)17-19-13-9-7-10-14-19)22-23(29-18-20-15-11-8-12-16-20)24-26(6-2,30-22)32-25(3,4)31-24/h5-16,21-24,28H,1-2,17-18H2,3-4H3/t21-,22+,23-,24+,26+/m1/s1 |
| InChIKey | RYKCSWLADDONHZ-OXCVBPRPSA-N |
| XLogP | 4.45 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|