C19H26O3 — CID 11012104
(1R,2R,4S,5R,6R)-2-ethenyl-6-(methoxymethoxy)-4-phenylmethoxybicyclo[3.2.1]octane (PubChem CID 11012104) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (1R,2R,4S,5R,6R)-2-ethenyl-6-(methoxymethoxy)-4-phenylmethoxybicyclo[3.2.1]octane.
| Compound Name | (1R,2R,4S,5R,6R)-2-ethenyl-6-(methoxymethoxy)-4-phenylmethoxybicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 11012104 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (1R,2R,4S,5R,6R)-2-ethenyl-6-(methoxymethoxy)-4-phenylmethoxybicyclo[3.2.1]octane |
| SMILES | C=C[C@H]1C[C@H](OCc2ccccc2)[C@H]2C[C@@H]1C[C@H]2OCOC |
| InChI | InChI=1S/C19H26O3/c1-3-15-10-18(21-12-14-7-5-4-6-8-14)17-9-16(15)11-19(17)22-13-20-2/h3-8,15-19H,1,9-13H2,2H3/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | SZVGSWFJYSMRTE-BRIYLRKRSA-N |
| XLogP | 3.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|