C16H20O6 — CID 101477369
(3aR,4R,7S,7aR)-4-(methoxymethoxy)-7-phenylmethoxy-3,3a,4,5,7,7a-hexahydrofuro[2,3-c]pyran-2-one (PubChem CID 101477369) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (3aR,4R,7S,7aR)-4-(methoxymethoxy)-7-phenylmethoxy-3,3a,4,5,7,7a-hexahydrofuro[2,3-c]pyran-2-one.
| Compound Name | (3aR,4R,7S,7aR)-4-(methoxymethoxy)-7-phenylmethoxy-3,3a,4,5,7,7a-hexahydrofuro[2,3-c]pyran-2-one |
|---|---|
| PubChem CID | 101477369 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3aR,4R,7S,7aR)-4-(methoxymethoxy)-7-phenylmethoxy-3,3a,4,5,7,7a-hexahydrofuro[2,3-c]pyran-2-one |
| SMILES | COCO[C@H]1CO[C@H](OCc2ccccc2)[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C16H20O6/c1-18-10-21-13-9-20-16(15-12(13)7-14(17)22-15)19-8-11-5-3-2-4-6-11/h2-6,12-13,15-16H,7-10H2,1H3/t12-,13+,15-,16+/m1/s1 |
| InChIKey | UXCBJRJSALBZST-CLWVCHIJSA-N |
| XLogP | 1.48 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|