C14H16O5 — CID 23255946
methyl (2R,4R)-6-oxo-4-phenylmethoxyoxane-2-carboxylate (PubChem CID 23255946) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl (2R,4R)-6-oxo-4-phenylmethoxyoxane-2-carboxylate.
| Compound Name | methyl (2R,4R)-6-oxo-4-phenylmethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 23255946 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | methyl (2R,4R)-6-oxo-4-phenylmethoxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](OCc2ccccc2)CC(=O)O1 |
| InChI | InChI=1S/C14H16O5/c1-17-14(16)12-7-11(8-13(15)19-12)18-9-10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | LZWBACGDIAAWFR-VXGBXAGGSA-N |
| XLogP | 1.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |