C21H23O7P — CID 123529663
methyl 4-[bis(phenylmethoxy)phosphorylmethyl]-5-oxooxolane-2-carboxylate (PubChem CID 123529663) has the molecular formula C21H23O7P and a molecular weight of 418.38 g/mol. Its IUPAC name is methyl 4-[bis(phenylmethoxy)phosphorylmethyl]-5-oxooxolane-2-carboxylate.
| Compound Name | methyl 4-[bis(phenylmethoxy)phosphorylmethyl]-5-oxooxolane-2-carboxylate |
|---|---|
| PubChem CID | 123529663 |
| Molecular Formula | C21H23O7P |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | methyl 4-[bis(phenylmethoxy)phosphorylmethyl]-5-oxooxolane-2-carboxylate |
| SMILES | COC(=O)C1CC(CP(=O)(OCc2ccccc2)OCc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C21H23O7P/c1-25-21(23)19-12-18(20(22)28-19)15-29(24,26-13-16-8-4-2-5-9-16)27-14-17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3 |
| InChIKey | NPIXOTFSCYEZOT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|