C13H16O4S — CID 134861174
2-[(2R)-2-(methoxymethoxy)cyclopropyl]ethenylsulfonylbenzene (PubChem CID 134861174) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-[(2R)-2-(methoxymethoxy)cyclopropyl]ethenylsulfonylbenzene.
| Compound Name | 2-[(2R)-2-(methoxymethoxy)cyclopropyl]ethenylsulfonylbenzene |
|---|---|
| PubChem CID | 134861174 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[(2R)-2-(methoxymethoxy)cyclopropyl]ethenylsulfonylbenzene |
| SMILES | COCO[C@@H]1CC1C=CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O4S/c1-16-10-17-13-9-11(13)7-8-18(14,15)12-5-3-2-4-6-12/h2-8,11,13H,9-10H2,1H3/t11?,13-/m1/s1 |
| InChIKey | KZYGZZLBLQJHQM-GLGOKHISSA-N |
| XLogP | 1.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|