C19H29NO4S — CID 10523011
(3R,4S,6S,9aS)-6-(benzenesulfonylmethyl)-3-(methoxymethoxy)-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 10523011) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is (3R,4S,6S,9aS)-6-(benzenesulfonylmethyl)-3-(methoxymethoxy)-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | (3R,4S,6S,9aS)-6-(benzenesulfonylmethyl)-3-(methoxymethoxy)-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 10523011 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (3R,4S,6S,9aS)-6-(benzenesulfonylmethyl)-3-(methoxymethoxy)-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | COCO[C@@H]1CC[C@@H]2CCC[C@@H](CS(=O)(=O)c3ccccc3)N2[C@H]1C |
| InChI | InChI=1S/C19H29NO4S/c1-15-19(24-14-23-2)12-11-16-7-6-8-17(20(15)16)13-25(21,22)18-9-4-3-5-10-18/h3-5,9-10,15-17,19H,6-8,11-14H2,1-2H3/t15-,16-,17-,19+/m0/s1 |
| InChIKey | SJSHVWGXXNPFBN-LSTDLKDCSA-N |
| XLogP | 2.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|