C35H47NO5SSi — CID 10817672
[(3R,4S,6S,9aS)-6-(benzenesulfonylmethyl)-3-(methoxymethoxy)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 10817672) has the molecular formula C35H47NO5SSi and a molecular weight of 621.92 g/mol. Its IUPAC name is [(3R,4S,6S,9aS)-6-(benzenesulfonylmethyl)-3-(methoxymethoxy)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3R,4S,6S,9aS)-6-(benzenesulfonylmethyl)-3-(methoxymethoxy)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10817672 |
| Molecular Formula | C35H47NO5SSi |
| Molecular Weight | 621.92 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | [(3R,4S,6S,9aS)-6-(benzenesulfonylmethyl)-3-(methoxymethoxy)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | COCO[C@@H]1CC[C@@H]2CCC[C@@H](CS(=O)(=O)c3ccccc3)N2[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H47NO5SSi/c1-35(2,3)43(31-19-10-6-11-20-31,32-21-12-7-13-22-32)41-25-33-34(40-27-39-4)24-23-28-15-14-16-29(36(28)33)26-42(37,38)30-17-8-5-9-18-30/h5-13,17-22,28-29,33-34H,14-16,23-27H2,1-4H3/t28-,29-,33-,34+/m0/s1 |
| InChIKey | LHKJHFQGBAZMMC-XULCBFKASA-N |
| XLogP | 5.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.92 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|