C15H20O4S — CID 11120018
(4R)-4-[(Z)-2-(benzenesulfonyl)ethenyl]-2,2-diethyl-1,3-dioxolane (PubChem CID 11120018) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is (4R)-4-[(Z)-2-(benzenesulfonyl)ethenyl]-2,2-diethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(Z)-2-(benzenesulfonyl)ethenyl]-2,2-diethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11120018 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (4R)-4-[(Z)-2-(benzenesulfonyl)ethenyl]-2,2-diethyl-1,3-dioxolane |
| SMILES | CCC1(CC)OC[C@@H](/C=C\S(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C15H20O4S/c1-3-15(4-2)18-12-13(19-15)10-11-20(16,17)14-8-6-5-7-9-14/h5-11,13H,3-4,12H2,1-2H3/b11-10-/t13-/m1/s1 |
| InChIKey | VXPZPRBLMXALNO-BSYHEUMXSA-N |
| XLogP | 2.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |