C12H16O3S — CID 14532903
3-(benzenesulfonyl)-2,2-diethyloxirane (PubChem CID 14532903) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2,2-diethyloxirane.
| Compound Name | 3-(benzenesulfonyl)-2,2-diethyloxirane |
|---|---|
| PubChem CID | 14532903 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 3-(benzenesulfonyl)-2,2-diethyloxirane |
| SMILES | CCC1(CC)OC1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16O3S/c1-3-12(4-2)11(15-12)16(13,14)10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
| InChIKey | FJJNSEJHPZOTIK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|