C14H20O4S — CID 101176021
(3R,4S,6R)-4-(benzenesulfonyl)-3-ethyl-6-methyloxan-3-ol (PubChem CID 101176021) has the molecular formula C14H20O4S and a molecular weight of 284.38 g/mol. Its IUPAC name is (3R,4S,6R)-4-(benzenesulfonyl)-3-ethyl-6-methyloxan-3-ol.
| Compound Name | (3R,4S,6R)-4-(benzenesulfonyl)-3-ethyl-6-methyloxan-3-ol |
|---|---|
| PubChem CID | 101176021 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (3R,4S,6R)-4-(benzenesulfonyl)-3-ethyl-6-methyloxan-3-ol |
| SMILES | CC[C@@]1(O)CO[C@H](C)C[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20O4S/c1-3-14(15)10-18-11(2)9-13(14)19(16,17)12-7-5-4-6-8-12/h4-8,11,13,15H,3,9-10H2,1-2H3/t11-,13+,14-/m1/s1 |
| InChIKey | IPEAPOXSIKWDND-KWCYVHTRSA-N |
| XLogP | 1.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |