C14H19ClO2 — CID 158961736
4-[(2-chlorophenyl)methyl]-2,2-diethyl-1,3-dioxolane (PubChem CID 158961736) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-2,2-diethyl-1,3-dioxolane.
| Compound Name | 4-[(2-chlorophenyl)methyl]-2,2-diethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 158961736 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-2,2-diethyl-1,3-dioxolane |
| SMILES | CCC1(CC)OCC(Cc2ccccc2Cl)O1 |
| InChI | InChI=1S/C14H19ClO2/c1-3-14(4-2)16-10-12(17-14)9-11-7-5-6-8-13(11)15/h5-8,12H,3-4,9-10H2,1-2H3 |
| InChIKey | JMSAIZTWJNOQGG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |