About (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane
(4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane (PubChem CID 131860944) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane |
| PubChem CID | 131860944 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane |
| SMILES | CCC1(CC)OC[C@H](CCOC)O1 |
| InChI | InChI=1S/C10H20O3/c1-4-10(5-2)12-8-9(13-10)6-7-11-3/h9H,4-8H2,1-3H3/t9-/m0/s1 |
| InChIKey | YLLPIFYYFPZUBA-VIFPVBQESA-N |
| XLogP | 1.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane?
The IUPAC name of (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane (CID 131860944) is (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane.
What is the SMILES notation for (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane?
The canonical SMILES for (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane is CCC1(CC)OC[C@H](CCOC)O1.
What is the InChIKey of (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane?
The InChIKey is YLLPIFYYFPZUBA-VIFPVBQESA-N. The full InChI is InChI=1S/C10H20O3/c1-4-10(5-2)12-8-9(13-10)6-7-11-3/h9H,4-8H2,1-3H3/t9-/m0/s1.
What are the key properties of (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane?
(4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane has a molecular weight of 188.27 g/mol, XLogP of 1.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,2-diethyl-4-(2-methoxyethyl)-1,3-dioxolane is sourced from PubChem (CID 131860944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).