C11H20O3S — CID 87982834
S-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethyl] ethanethioate (PubChem CID 87982834) has the molecular formula C11H20O3S and a molecular weight of 232.34 g/mol. Its IUPAC name is S-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethyl] ethanethioate.
| Compound Name | S-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethyl] ethanethioate |
|---|---|
| PubChem CID | 87982834 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | S-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethyl] ethanethioate |
| SMILES | CCC1(CC)OCC(CCSC(C)=O)O1 |
| InChI | InChI=1S/C11H20O3S/c1-4-11(5-2)13-8-10(14-11)6-7-15-9(3)12/h10H,4-8H2,1-3H3 |
| InChIKey | LUTIDOPNEUQUIN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|