C16H30O6 — CID 15929605
(1S,2S)-1,2-bis[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]ethane-1,2-diol (PubChem CID 15929605) has the molecular formula C16H30O6 and a molecular weight of 318.41 g/mol. Its IUPAC name is (1S,2S)-1,2-bis[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]ethane-1,2-diol.
| Compound Name | (1S,2S)-1,2-bis[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 15929605 |
| Molecular Formula | C16H30O6 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (1S,2S)-1,2-bis[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
| SMILES | CCC1(CC)OC[C@H]([C@@H](O)[C@H](O)[C@H]2COC(CC)(CC)O2)O1 |
| InChI | InChI=1S/C16H30O6/c1-5-15(6-2)19-9-11(21-15)13(17)14(18)12-10-20-16(7-3,8-4)22-12/h11-14,17-18H,5-10H2,1-4H3/t11-,12-,13-,14-/m1/s1 |
| InChIKey | TXNONHSODIEOGH-AAVRWANBSA-N |
| XLogP | 1.57 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |