C11H19BrO2 — CID 11807504
(4S)-4-[(E)-3-bromobut-2-enyl]-2,2-diethyl-1,3-dioxolane (PubChem CID 11807504) has the molecular formula C11H19BrO2 and a molecular weight of 263.17 g/mol. Its IUPAC name is (4S)-4-[(E)-3-bromobut-2-enyl]-2,2-diethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(E)-3-bromobut-2-enyl]-2,2-diethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11807504 |
| Molecular Formula | C11H19BrO2 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (4S)-4-[(E)-3-bromobut-2-enyl]-2,2-diethyl-1,3-dioxolane |
| SMILES | CCC1(CC)OC[C@H](C/C=C(\C)Br)O1 |
| InChI | InChI=1S/C11H19BrO2/c1-4-11(5-2)13-8-10(14-11)7-6-9(3)12/h6,10H,4-5,7-8H2,1-3H3/b9-6+/t10-/m0/s1 |
| InChIKey | QCPREAAFUKKSCV-ZKXNXJMVSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |