C9H14BrFO2 — CID 71338163
4-(4-bromo-3-fluorobut-2-enyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 71338163) has the molecular formula C9H14BrFO2 and a molecular weight of 253.11 g/mol. Its IUPAC name is 4-(4-bromo-3-fluorobut-2-enyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-(4-bromo-3-fluorobut-2-enyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 71338163 |
| Molecular Formula | C9H14BrFO2 |
| Molecular Weight | 253.11 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 4-(4-bromo-3-fluorobut-2-enyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(CC=C(F)CBr)O1 |
| InChI | InChI=1S/C9H14BrFO2/c1-9(2)12-6-8(13-9)4-3-7(11)5-10/h3,8H,4-6H2,1-2H3 |
| InChIKey | FOKCQADACDCFJI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.11 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|