C31H54O9 — CID 158433915
bis[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]methanone;(4R)-4-[1-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]ethenyl]-2,2-diethyl-1,3-dioxolane (PubChem CID 158433915) has the molecular formula C31H54O9 and a molecular weight of 570.76 g/mol. Its IUPAC name is bis[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]methanone;(4R)-4-[1-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]ethenyl]-2,2-diethyl-1,3-dioxolane.
| Compound Name | bis[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]methanone;(4R)-4-[1-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]ethenyl]-2,2-diethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 158433915 |
| Molecular Formula | C31H54O9 |
| Molecular Weight | 570.76 g/mol |
| Exact Mass | 570.38 |
| IUPAC Name | bis[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]methanone;(4R)-4-[1-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]ethenyl]-2,2-diethyl-1,3-dioxolane |
| SMILES | C=C([C@@H]1COC(CC)(CC)O1)[C@@H]1COC(CC)(CC)O1.CCC1(CC)OC[C@@H](C(=O)[C@@H]2COC(CC)(CC)O2)O1 |
| InChI | InChI=1S/C16H28O4.C15H26O5/c1-6-15(7-2)17-10-13(19-15)12(5)14-11-18-16(8-3,9-4)20-14;1-5-14(6-2)17-9-11(19-14)13(16)12-10-18-15(7-3,8-4)20-12/h13-14H,5-11H2,1-4H3;11-12H,5-10H2,1-4H3/t13-,14-;11-,12-/m00/s1 |
| InChIKey | HBZKSLLZXWGKKV-ZDWMDZISSA-N |
| XLogP | 5.82 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.76 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|