C25H40O5SSi — CID 11730528
[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-1-phenylsulfanylbut-3-enyl] acetate (PubChem CID 11730528) has the molecular formula C25H40O5SSi and a molecular weight of 480.74 g/mol. Its IUPAC name is [(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-1-phenylsulfanylbut-3-enyl] acetate.
| Compound Name | [(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-1-phenylsulfanylbut-3-enyl] acetate |
|---|---|
| PubChem CID | 11730528 |
| Molecular Formula | C25H40O5SSi |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | [(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-1-phenylsulfanylbut-3-enyl] acetate |
| SMILES | C=C([C@H]1COC(CC)(CC)O1)[C@H](O[Si](C)(C)C(C)(C)C)C(OC(C)=O)Sc1ccccc1 |
| InChI | InChI=1S/C25H40O5SSi/c1-10-25(11-2)27-17-21(29-25)18(3)22(30-32(8,9)24(5,6)7)23(28-19(4)26)31-20-15-13-12-14-16-20/h12-16,21-23H,3,10-11,17H2,1-2,4-9H3/t21-,22+,23?/m1/s1 |
| InChIKey | RSEGIIDHKXNBEC-AXWGZAFASA-N |
| XLogP | 6.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|