C9H17NO3S — CID 101002615
S-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] N-ethylcarbamothioate (PubChem CID 101002615) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is S-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] N-ethylcarbamothioate.
| Compound Name | S-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] N-ethylcarbamothioate |
|---|---|
| PubChem CID | 101002615 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | S-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] N-ethylcarbamothioate |
| SMILES | CCNC(=O)SC[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C9H17NO3S/c1-4-10-8(11)14-6-7-5-12-9(2,3)13-7/h7H,4-6H2,1-3H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | UPAPKSXQIGCSJD-SSDOTTSWSA-N |
| XLogP | 1.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|