About [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate
[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate (PubChem CID 101002617) has the molecular formula C9H17NO2S2
and a molecular weight of 235.37 g/mol. Its IUPAC name is [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate.
Molecular Properties
| Compound Name | [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate |
| PubChem CID | 101002617 |
| Molecular Formula | C9H17NO2S2 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate |
| SMILES | CCNC(=S)SC[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C9H17NO2S2/c1-4-10-8(13)14-6-7-5-11-9(2,3)12-7/h7H,4-6H2,1-3H3,(H,10,13)/t7-/m1/s1 |
| InChIKey | HKDBXBAYROCAGO-SSDOTTSWSA-N |
| XLogP | 1.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate?
The IUPAC name of [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate (CID 101002617) is [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate.
What is the SMILES notation for [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate?
The canonical SMILES for [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate is CCNC(=S)SC[C@H]1COC(C)(C)O1.
What is the InChIKey of [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate?
The InChIKey is HKDBXBAYROCAGO-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H17NO2S2/c1-4-10-8(13)14-6-7-5-11-9(2,3)12-7/h7H,4-6H2,1-3H3,(H,10,13)/t7-/m1/s1.
What are the key properties of [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate?
[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate has a molecular weight of 235.37 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate is sourced from PubChem (CID 101002617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).