C9H17NO2S2 — CID 101002617
[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate (PubChem CID 101002617) has the molecular formula C9H17NO2S2 and a molecular weight of 235.37 g/mol. Its IUPAC name is [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate.
| Compound Name | [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate |
|---|---|
| PubChem CID | 101002617 |
| Molecular Formula | C9H17NO2S2 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl N-ethylcarbamodithioate |
| SMILES | CCNC(=S)SC[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C9H17NO2S2/c1-4-10-8(13)14-6-7-5-11-9(2,3)12-7/h7H,4-6H2,1-3H3,(H,10,13)/t7-/m1/s1 |
| InChIKey | HKDBXBAYROCAGO-SSDOTTSWSA-N |
| XLogP | 1.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|