C13H25NO4S — CID 46205783
tert-butyl N-[2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylsulfanyl]ethyl]carbamate (PubChem CID 46205783) has the molecular formula C13H25NO4S and a molecular weight of 291.41 g/mol. Its IUPAC name is tert-butyl N-[2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylsulfanyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylsulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 46205783 |
| Molecular Formula | C13H25NO4S |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | tert-butyl N-[2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylsulfanyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSC[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C13H25NO4S/c1-12(2,3)18-11(15)14-6-7-19-9-10-8-16-13(4,5)17-10/h10H,6-9H2,1-5H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | DFBPYYXTNSKQMS-SNVBAGLBSA-N |
| XLogP | 2.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|