C17H34N2O4 — CID 154787554
tert-butyl N-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]-4-methylpentyl]carbamate (PubChem CID 154787554) has the molecular formula C17H34N2O4 and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl N-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]-4-methylpentyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]-4-methylpentyl]carbamate |
|---|---|
| PubChem CID | 154787554 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | tert-butyl N-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]-4-methylpentyl]carbamate |
| SMILES | CC(C)(CCCNC(=O)OC(C)(C)C)NC[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H34N2O4/c1-15(2,3)23-14(20)18-10-8-9-16(4,5)19-11-13-12-21-17(6,7)22-13/h13,19H,8-12H2,1-7H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | BACRGJFPUWHABU-ZDUSSCGKSA-N |
| XLogP | 2.81 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|