C13H17IO2 — CID 151760345
2,2-diethyl-4-(2-iodophenyl)-1,3-dioxolane (PubChem CID 151760345) has the molecular formula C13H17IO2 and a molecular weight of 332.18 g/mol. Its IUPAC name is 2,2-diethyl-4-(2-iodophenyl)-1,3-dioxolane.
| Compound Name | 2,2-diethyl-4-(2-iodophenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 151760345 |
| Molecular Formula | C13H17IO2 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 2,2-diethyl-4-(2-iodophenyl)-1,3-dioxolane |
| SMILES | CCC1(CC)OCC(c2ccccc2I)O1 |
| InChI | InChI=1S/C13H17IO2/c1-3-13(4-2)15-9-12(16-13)10-7-5-6-8-11(10)14/h5-8,12H,3-4,9H2,1-2H3 |
| InChIKey | RQKUIBMXXJWHMQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|