About 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol
2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol (PubChem CID 117347005) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol.
Molecular Properties
| Compound Name | 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol |
| PubChem CID | 117347005 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol |
| SMILES | CC1(C)OCC(c2ccccc2C(N)CO)O1 |
| InChI | InChI=1S/C13H19NO3/c1-13(2)16-8-12(17-13)10-6-4-3-5-9(10)11(14)7-15/h3-6,11-12,15H,7-8,14H2,1-2H3 |
| InChIKey | AITXGHVVHRWZAS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol?
The IUPAC name of 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol (CID 117347005) is 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol.
What is the SMILES notation for 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol?
The canonical SMILES for 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol is CC1(C)OCC(c2ccccc2C(N)CO)O1.
What is the InChIKey of 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol?
The InChIKey is AITXGHVVHRWZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-13(2)16-8-12(17-13)10-6-4-3-5-9(10)11(14)7-15/h3-6,11-12,15H,7-8,14H2,1-2H3.
What are the key properties of 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol?
2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol has a molecular weight of 237.30 g/mol, XLogP of 1.50, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]ethanol is sourced from PubChem (CID 117347005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).