About 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol
1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol (PubChem CID 117374015) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol.
Molecular Properties
| Compound Name | 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol |
| PubChem CID | 117374015 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol |
| SMILES | CC1(C)OCC(c2ccccc2CC2(O)CC2)O1 |
| InChI | InChI=1S/C15H20O3/c1-14(2)17-10-13(18-14)12-6-4-3-5-11(12)9-15(16)7-8-15/h3-6,13,16H,7-10H2,1-2H3 |
| InChIKey | QHWPEUYVSPZLBG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol?
The IUPAC name of 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol (CID 117374015) is 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol.
What is the SMILES notation for 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol?
The canonical SMILES for 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol is CC1(C)OCC(c2ccccc2CC2(O)CC2)O1.
What is the InChIKey of 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol?
The InChIKey is QHWPEUYVSPZLBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-14(2)17-10-13(18-14)12-6-4-3-5-11(12)9-15(16)7-8-15/h3-6,13,16H,7-10H2,1-2H3.
What are the key properties of 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol?
1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol has a molecular weight of 248.32 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]methyl]cyclopropan-1-ol is sourced from PubChem (CID 117374015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).