C13H15NO5S — CID 125434642
[(S)-cyano-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] benzenesulfonate (PubChem CID 125434642) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is [(S)-cyano-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] benzenesulfonate.
| Compound Name | [(S)-cyano-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] benzenesulfonate |
|---|---|
| PubChem CID | 125434642 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | [(S)-cyano-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] benzenesulfonate |
| SMILES | CC1(C)OC[C@H]([C@H](C#N)OS(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C13H15NO5S/c1-13(2)17-9-12(18-13)11(8-14)19-20(15,16)10-6-4-3-5-7-10/h3-7,11-12H,9H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | GQVRSSHQUOZMTM-NWDGAFQWSA-N |
| XLogP | 1.44 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|