C13H15NO3S — CID 155011024
[cyano(cyclobutyl)methyl] 4-methylbenzenesulfonate (PubChem CID 155011024) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is [cyano(cyclobutyl)methyl] 4-methylbenzenesulfonate.
| Compound Name | [cyano(cyclobutyl)methyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 155011024 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | [cyano(cyclobutyl)methyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C#N)C2CCC2)cc1 |
| InChI | InChI=1S/C13H15NO3S/c1-10-5-7-12(8-6-10)18(15,16)17-13(9-14)11-3-2-4-11/h5-8,11,13H,2-4H2,1H3 |
| InChIKey | JEORPTZGMHVEJP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|