C20H25NO3S — CID 125113754
[(R)-[(4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]-cyanomethyl] 4-methylbenzenesulfonate (PubChem CID 125113754) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is [(R)-[(4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]-cyanomethyl] 4-methylbenzenesulfonate.
| Compound Name | [(R)-[(4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]-cyanomethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 125113754 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | [(R)-[(4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]-cyanomethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H](C#N)C2=CC[C@]3(C)CCCC[C@H]3C2)cc1 |
| InChI | InChI=1S/C20H25NO3S/c1-15-6-8-18(9-7-15)25(22,23)24-19(14-21)16-10-12-20(2)11-4-3-5-17(20)13-16/h6-10,17,19H,3-5,11-13H2,1-2H3/t17-,19-,20-/m0/s1 |
| InChIKey | GNDJUDNWGIJALR-IHPCNDPISA-N |
| XLogP | 4.51 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|