C20H30O4S — CID 13006017
[(2R,3S,4aR,8aS)-3-hydroxy-4,4,8a-trimethyl-1,2,3,4a,5,6,7,8-octahydronaphthalen-2-yl] 4-methylbenzenesulfonate (PubChem CID 13006017) has the molecular formula C20H30O4S and a molecular weight of 366.52 g/mol. Its IUPAC name is [(2R,3S,4aR,8aS)-3-hydroxy-4,4,8a-trimethyl-1,2,3,4a,5,6,7,8-octahydronaphthalen-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4aR,8aS)-3-hydroxy-4,4,8a-trimethyl-1,2,3,4a,5,6,7,8-octahydronaphthalen-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13006017 |
| Molecular Formula | C20H30O4S |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [(2R,3S,4aR,8aS)-3-hydroxy-4,4,8a-trimethyl-1,2,3,4a,5,6,7,8-octahydronaphthalen-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2C[C@]3(C)CCCC[C@H]3C(C)(C)[C@@H]2O)cc1 |
| InChI | InChI=1S/C20H30O4S/c1-14-8-10-15(11-9-14)25(22,23)24-16-13-20(4)12-6-5-7-17(20)19(2,3)18(16)21/h8-11,16-18,21H,5-7,12-13H2,1-4H3/t16-,17+,18-,20+/m1/s1 |
| InChIKey | ZTXFNOASWIQAAW-RMJJICAUSA-N |
| XLogP | 4.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|