C16H16N2O4S — CID 154419942
[cyano-(6-imino-4-methoxycyclohexa-2,4-dien-1-yl)methyl] 4-methylbenzenesulfonate (PubChem CID 154419942) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is [cyano-(6-imino-4-methoxycyclohexa-2,4-dien-1-yl)methyl] 4-methylbenzenesulfonate.
| Compound Name | [cyano-(6-imino-4-methoxycyclohexa-2,4-dien-1-yl)methyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154419942 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [cyano-(6-imino-4-methoxycyclohexa-2,4-dien-1-yl)methyl] 4-methylbenzenesulfonate |
| SMILES | [H]/N=C1\C=C(OC)C=CC1C(C#N)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H16N2O4S/c1-11-3-6-13(7-4-11)23(19,20)22-16(10-17)14-8-5-12(21-2)9-15(14)18/h3-9,14,16,18H,1-2H3/b18-15+ |
| InChIKey | BZZDXIQZPMGEBH-OBGWFSINSA-N |
| XLogP | 2.33 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|