C6H12O6S — CID 123663147
(2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid (PubChem CID 123663147) has the molecular formula C6H12O6S and a molecular weight of 212.22 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid |
|---|---|
| PubChem CID | 123663147 |
| Molecular Formula | C6H12O6S |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid |
| SMILES | CC1(C)OCC(C(O)S(=O)(=O)O)O1 |
| InChI | InChI=1S/C6H12O6S/c1-6(2)11-3-4(12-6)5(7)13(8,9)10/h4-5,7H,3H2,1-2H3,(H,8,9,10) |
| InChIKey | RTSRVAYOSGAUPB-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|