(2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid

C6H12O6S — CID 123663147

IUPAC(2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid
SMILESCC1(C)OCC(C(O)S(=O)(=O)O)O1
InChIInChI=1S/C6H12O6S/c1-6(2)11-3-4(12-6)5(7)13(8,9)10/h4-5,7H,3H2,1-2H3,(H,8,9,10)
InChIKeyRTSRVAYOSGAUPB-UHFFFAOYSA-N
MW212.22 g/mol
LogP-0.66
Rot. Bonds2

About (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid

(2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid (PubChem CID 123663147) has the molecular formula C6H12O6S and a molecular weight of 212.22 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid.

Molecular Properties

Compound Name(2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid
PubChem CID123663147
Molecular FormulaC6H12O6S
Molecular Weight212.22 g/mol
Exact Mass212.04
IUPAC Name(2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid
SMILESCC1(C)OCC(C(O)S(=O)(=O)O)O1
InChIInChI=1S/C6H12O6S/c1-6(2)11-3-4(12-6)5(7)13(8,9)10/h4-5,7H,3H2,1-2H3,(H,8,9,10)
InChIKeyRTSRVAYOSGAUPB-UHFFFAOYSA-N
XLogP-0.66
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.22
LogP ≤ 5-0.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid?
The IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid (CID 123663147) is (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid.
What is the SMILES notation for (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid?
The canonical SMILES for (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid is CC1(C)OCC(C(O)S(=O)(=O)O)O1.
What is the InChIKey of (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid?
The InChIKey is RTSRVAYOSGAUPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O6S/c1-6(2)11-3-4(12-6)5(7)13(8,9)10/h4-5,7H,3H2,1-2H3,(H,8,9,10).
What are the key properties of (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid?
(2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid has a molecular weight of 212.22 g/mol, XLogP of -0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1,3-dioxolan-4-yl)-hydroxymethanesulfonic acid is sourced from PubChem (CID 123663147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).