C7H14O5S — CID 87931342
1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethanesulfonic acid (PubChem CID 87931342) has the molecular formula C7H14O5S and a molecular weight of 210.25 g/mol. Its IUPAC name is 1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethanesulfonic acid.
| Compound Name | 1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethanesulfonic acid |
|---|---|
| PubChem CID | 87931342 |
| Molecular Formula | C7H14O5S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethanesulfonic acid |
| SMILES | CC(C1COC(C)(C)O1)S(=O)(=O)O |
| InChI | InChI=1S/C7H14O5S/c1-5(13(8,9)10)6-4-11-7(2,3)12-6/h5-6H,4H2,1-3H3,(H,8,9,10) |
| InChIKey | CMRYFLBIAUDFLH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|