C9H15FO7S — CID 89090352
[(2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methyl-3-oxopropyl] hydrogen sulfate (PubChem CID 89090352) has the molecular formula C9H15FO7S and a molecular weight of 286.28 g/mol. Its IUPAC name is [(2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methyl-3-oxopropyl] hydrogen sulfate.
| Compound Name | [(2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methyl-3-oxopropyl] hydrogen sulfate |
|---|---|
| PubChem CID | 89090352 |
| Molecular Formula | C9H15FO7S |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | [(2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methyl-3-oxopropyl] hydrogen sulfate |
| SMILES | CC1(C)OC[C@H](C(OS(=O)(=O)O)[C@@](C)(F)C=O)O1 |
| InChI | InChI=1S/C9H15FO7S/c1-8(2)15-4-6(16-8)7(9(3,10)5-11)17-18(12,13)14/h5-7H,4H2,1-3H3,(H,12,13,14)/t6-,7?,9+/m1/s1 |
| InChIKey | JEIOMIWRLLLMMW-YUTBPMSOSA-N |
| XLogP | 0.25 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|