C12H16F2O4 — CID 91987947
[1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobut-3-enyl] prop-2-enoate (PubChem CID 91987947) has the molecular formula C12H16F2O4 and a molecular weight of 262.25 g/mol. Its IUPAC name is [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobut-3-enyl] prop-2-enoate.
| Compound Name | [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobut-3-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 91987947 |
| Molecular Formula | C12H16F2O4 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobut-3-enyl] prop-2-enoate |
| SMILES | C=CC(=O)OC([C@H]1COC(C)(C)O1)C(F)(F)C=C |
| InChI | InChI=1S/C12H16F2O4/c1-5-9(15)17-10(12(13,14)6-2)8-7-16-11(3,4)18-8/h5-6,8,10H,1-2,7H2,3-4H3/t8-,10?/m1/s1 |
| InChIKey | NPTPZRKJZSYWGW-HNHGDDPOSA-N |
| XLogP | 2.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|