C19H32O7 — CID 10785515
[(1R,2R)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxybut-3-enyl] 2,2-dimethylpropanoate (PubChem CID 10785515) has the molecular formula C19H32O7 and a molecular weight of 372.46 g/mol. Its IUPAC name is [(1R,2R)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxybut-3-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,2R)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxybut-3-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10785515 |
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | [(1R,2R)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxybut-3-enyl] 2,2-dimethylpropanoate |
| SMILES | C=C[C@](O)([C@H](OC(=O)C(C)(C)C)[C@H]1COC(C)(C)O1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H32O7/c1-9-19(21,13-11-23-18(7,8)26-13)14(24-15(20)16(2,3)4)12-10-22-17(5,6)25-12/h9,12-14,21H,1,10-11H2,2-8H3/t12-,13-,14-,19-/m1/s1 |
| InChIKey | DVTOZIKJZXRJRG-QGDIXAPHSA-N |
| XLogP | 2.16 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|