C20H28O6S — CID 102122701
methyl (3S,4R)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methylhept-5-enoate (PubChem CID 102122701) has the molecular formula C20H28O6S and a molecular weight of 396.51 g/mol. Its IUPAC name is methyl (3S,4R)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methylhept-5-enoate.
| Compound Name | methyl (3S,4R)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methylhept-5-enoate |
|---|---|
| PubChem CID | 102122701 |
| Molecular Formula | C20H28O6S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | methyl (3S,4R)-4-(benzenesulfonyl)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methylhept-5-enoate |
| SMILES | COC(=O)C[C@H]([C@@H](C=C(C)C)S(=O)(=O)c1ccccc1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H28O6S/c1-14(2)11-18(27(22,23)15-9-7-6-8-10-15)16(12-19(21)24-5)17-13-25-20(3,4)26-17/h6-11,16-18H,12-13H2,1-5H3/t16-,17+,18+/m0/s1 |
| InChIKey | DGQJQYPMEBUYQJ-RCCFBDPRSA-N |
| XLogP | 3.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|