About N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine
N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine (PubChem CID 11153430) has the molecular formula C24H21NO2S
and a molecular weight of 387.50 g/mol. Its IUPAC name is N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine.
Molecular Properties
| Compound Name | N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine |
| PubChem CID | 11153430 |
| Molecular Formula | C24H21NO2S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine |
| SMILES | O=S(=O)(/C=C/[C@@H]1C[C@H]1N=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21NO2S/c26-28(27,22-14-8-3-9-15-22)17-16-21-18-23(21)25-24(19-10-4-1-5-11-19)20-12-6-2-7-13-20/h1-17,21,23H,18H2/b17-16+/t21-,23-/m1/s1 |
| InChIKey | BLQMEESUEOOKGH-GWHMAVBBSA-N |
| XLogP | 4.90 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine?
The IUPAC name of N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine (CID 11153430) is N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine.
What is the SMILES notation for N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine?
The canonical SMILES for N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine is O=S(=O)(/C=C/[C@@H]1C[C@H]1N=C(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine?
The InChIKey is BLQMEESUEOOKGH-GWHMAVBBSA-N. The full InChI is InChI=1S/C24H21NO2S/c26-28(27,22-14-8-3-9-15-22)17-16-21-18-23(21)25-24(19-10-4-1-5-11-19)20-12-6-2-7-13-20/h1-17,21,23H,18H2/b17-16+/t21-,23-/m1/s1.
What are the key properties of N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine?
N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine has a molecular weight of 387.50 g/mol, XLogP of 4.90, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]-1,1-diphenylmethanimine is sourced from PubChem (CID 11153430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).