C14H18O3S — CID 14785612
1-[(E)-2-(benzenesulfonyl)ethenyl]cyclohexan-1-ol (PubChem CID 14785612) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is 1-[(E)-2-(benzenesulfonyl)ethenyl]cyclohexan-1-ol.
| Compound Name | 1-[(E)-2-(benzenesulfonyl)ethenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 14785612 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 1-[(E)-2-(benzenesulfonyl)ethenyl]cyclohexan-1-ol |
| SMILES | O=S(=O)(/C=C/C1(O)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C14H18O3S/c15-14(9-5-2-6-10-14)11-12-18(16,17)13-7-3-1-4-8-13/h1,3-4,7-8,11-12,15H,2,5-6,9-10H2/b12-11+ |
| InChIKey | KFIFLSDMDGQPEO-VAWYXSNFSA-N |
| XLogP | 2.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |