C15H19NO3S — CID 76873750
3-(benzenesulfonyl)-N-cyclohexylprop-2-enamide (PubChem CID 76873750) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-cyclohexylprop-2-enamide.
| Compound Name | 3-(benzenesulfonyl)-N-cyclohexylprop-2-enamide |
|---|---|
| PubChem CID | 76873750 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-(benzenesulfonyl)-N-cyclohexylprop-2-enamide |
| SMILES | O=C(C=CS(=O)(=O)c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C15H19NO3S/c17-15(16-13-7-3-1-4-8-13)11-12-20(18,19)14-9-5-2-6-10-14/h2,5-6,9-13H,1,3-4,7-8H2,(H,16,17) |
| InChIKey | RHNKRLQJWRCZFJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|