C15H19NO4S — CID 106364399
(E)-3-(benzenesulfonyl)-N-[2-(hydroxymethyl)cyclopentyl]prop-2-enamide (PubChem CID 106364399) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is (E)-3-(benzenesulfonyl)-N-[2-(hydroxymethyl)cyclopentyl]prop-2-enamide.
| Compound Name | (E)-3-(benzenesulfonyl)-N-[2-(hydroxymethyl)cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 106364399 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (E)-3-(benzenesulfonyl)-N-[2-(hydroxymethyl)cyclopentyl]prop-2-enamide |
| SMILES | O=C(/C=C/S(=O)(=O)c1ccccc1)NC1CCCC1CO |
| InChI | InChI=1S/C15H19NO4S/c17-11-12-5-4-8-14(12)16-15(18)9-10-21(19,20)13-6-2-1-3-7-13/h1-3,6-7,9-10,12,14,17H,4-5,8,11H2,(H,16,18)/b10-9+ |
| InChIKey | NTAWJFQDVIHDTF-MDZDMXLPSA-N |
| XLogP | 1.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|