C16H21NO3S — CID 114550405
(E)-3-(benzenesulfonyl)-N-(3,3-dimethylcyclopentyl)prop-2-enamide (PubChem CID 114550405) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is (E)-3-(benzenesulfonyl)-N-(3,3-dimethylcyclopentyl)prop-2-enamide.
| Compound Name | (E)-3-(benzenesulfonyl)-N-(3,3-dimethylcyclopentyl)prop-2-enamide |
|---|---|
| PubChem CID | 114550405 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (E)-3-(benzenesulfonyl)-N-(3,3-dimethylcyclopentyl)prop-2-enamide |
| SMILES | CC1(C)CCC(NC(=O)/C=C/S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H21NO3S/c1-16(2)10-8-13(12-16)17-15(18)9-11-21(19,20)14-6-4-3-5-7-14/h3-7,9,11,13H,8,10,12H2,1-2H3,(H,17,18)/b11-9+ |
| InChIKey | MYZASLOFWBFYNI-PKNBQFBNSA-N |
| XLogP | 2.67 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|