C17H23NO — CID 114550472
(E)-N-(3,3-dimethylcyclopentyl)-3-(3-methylphenyl)prop-2-enamide (PubChem CID 114550472) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (E)-N-(3,3-dimethylcyclopentyl)-3-(3-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(3,3-dimethylcyclopentyl)-3-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 114550472 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (E)-N-(3,3-dimethylcyclopentyl)-3-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(/C=C/C(=O)NC2CCC(C)(C)C2)c1 |
| InChI | InChI=1S/C17H23NO/c1-13-5-4-6-14(11-13)7-8-16(19)18-15-9-10-17(2,3)12-15/h4-8,11,15H,9-10,12H2,1-3H3,(H,18,19)/b8-7+ |
| InChIKey | GESFXESZVOJAAU-BQYQJAHWSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|