C22H27O2P — CID 15981536
1-[(E)-2-dibenzylphosphorylethenyl]cyclohexan-1-ol (PubChem CID 15981536) has the molecular formula C22H27O2P and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-[(E)-2-dibenzylphosphorylethenyl]cyclohexan-1-ol.
| Compound Name | 1-[(E)-2-dibenzylphosphorylethenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 15981536 |
| Molecular Formula | C22H27O2P |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[(E)-2-dibenzylphosphorylethenyl]cyclohexan-1-ol |
| SMILES | O=P(/C=C/C1(O)CCCCC1)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H27O2P/c23-22(14-8-3-9-15-22)16-17-25(24,18-20-10-4-1-5-11-20)19-21-12-6-2-7-13-21/h1-2,4-7,10-13,16-17,23H,3,8-9,14-15,18-19H2/b17-16+ |
| InChIKey | YOLLLPSGFMHKMQ-WUKNDPDISA-N |
| XLogP | 5.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|