C13H18N2O3S — CID 103308699
1-amino-N-(benzenesulfonyl)cyclohexane-1-carboxamide (PubChem CID 103308699) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-amino-N-(benzenesulfonyl)cyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-(benzenesulfonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 103308699 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-amino-N-(benzenesulfonyl)cyclohexane-1-carboxamide |
| SMILES | NC1(C(=O)NS(=O)(=O)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C13H18N2O3S/c14-13(9-5-2-6-10-13)12(16)15-19(17,18)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10,14H2,(H,15,16) |
| InChIKey | AWRYGOWKMAUNRL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |