C12H16N2O3S — CID 103308752
1-(aminomethyl)-N-(benzenesulfonyl)cyclobutane-1-carboxamide (PubChem CID 103308752) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(benzenesulfonyl)cyclobutane-1-carboxamide.
| Compound Name | 1-(aminomethyl)-N-(benzenesulfonyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 103308752 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1-(aminomethyl)-N-(benzenesulfonyl)cyclobutane-1-carboxamide |
| SMILES | NCC1(C(=O)NS(=O)(=O)c2ccccc2)CCC1 |
| InChI | InChI=1S/C12H16N2O3S/c13-9-12(7-4-8-12)11(15)14-18(16,17)10-5-2-1-3-6-10/h1-3,5-6H,4,7-9,13H2,(H,14,15) |
| InChIKey | YQGGCAQCYVGCOS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |