C14H20O3S — CID 899860
cis-(1R,2S)-2-(benzenesulfonyl)-1,2-dimethylcyclohexan-1-ol (PubChem CID 899860) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is cis-(1R,2S)-2-(benzenesulfonyl)-1,2-dimethylcyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-(benzenesulfonyl)-1,2-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 899860 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | cis-(1R,2S)-2-(benzenesulfonyl)-1,2-dimethylcyclohexan-1-ol |
| SMILES | C[C@]1(S(=O)(=O)c2ccccc2)CCCC[C@@]1(C)O |
| InChI | InChI=1S/C14H20O3S/c1-13(15)10-6-7-11-14(13,2)18(16,17)12-8-4-3-5-9-12/h3-5,8-9,15H,6-7,10-11H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | CAANQXUBBLMKLR-KGLIPLIRSA-N |
| XLogP | 2.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |