C17H23NO4S — CID 118768125
1-(benzenesulfonyl)-N-[(1-hydroxycyclohexyl)methyl]cyclopropane-1-carboxamide (PubChem CID 118768125) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[(1-hydroxycyclohexyl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[(1-hydroxycyclohexyl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 118768125 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[(1-hydroxycyclohexyl)methyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCC1(O)CCCCC1)C1(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H23NO4S/c19-15(18-13-16(20)9-5-2-6-10-16)17(11-12-17)23(21,22)14-7-3-1-4-8-14/h1,3-4,7-8,20H,2,5-6,9-13H2,(H,18,19) |
| InChIKey | CNCUTBHESVBPRG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |