C14H19NO3 — CID 65110390
phenyl N-[(1-hydroxycyclohexyl)methyl]carbamate (PubChem CID 65110390) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is phenyl N-[(1-hydroxycyclohexyl)methyl]carbamate.
| Compound Name | phenyl N-[(1-hydroxycyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 65110390 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | phenyl N-[(1-hydroxycyclohexyl)methyl]carbamate |
| SMILES | O=C(NCC1(O)CCCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C14H19NO3/c16-13(18-12-7-3-1-4-8-12)15-11-14(17)9-5-2-6-10-14/h1,3-4,7-8,17H,2,5-6,9-11H2,(H,15,16) |
| InChIKey | NDIJYUAJSVOTGJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |