C15H22N2O3 — CID 125117285
benzyl N-[[(4R)-4-hydroxyazepan-4-yl]methyl]carbamate (PubChem CID 125117285) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is benzyl N-[[(4R)-4-hydroxyazepan-4-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(4R)-4-hydroxyazepan-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 125117285 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | benzyl N-[[(4R)-4-hydroxyazepan-4-yl]methyl]carbamate |
| SMILES | O=C(NC[C@@]1(O)CCCNCC1)OCc1ccccc1 |
| InChI | InChI=1S/C15H22N2O3/c18-14(20-11-13-5-2-1-3-6-13)17-12-15(19)7-4-9-16-10-8-15/h1-3,5-6,16,19H,4,7-12H2,(H,17,18)/t15-/m1/s1 |
| InChIKey | WFNSIJPBNMYFGZ-OAHLLOKOSA-N |
| XLogP | 1.42 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |